C22H47N3O2 — CID 170039013
N-[[4-[2-[2-(tert-butylamino)ethoxy]ethyl]morpholin-2-yl]methyl]-2-methyl-2-propylpentan-1-amine (PubChem CID 170039013) has the molecular formula C22H47N3O2 and a molecular weight of 385.64 g/mol. Its IUPAC name is N-[[4-[2-[2-(tert-butylamino)ethoxy]ethyl]morpholin-2-yl]methyl]-2-methyl-2-propylpentan-1-amine.
| Compound Name | N-[[4-[2-[2-(tert-butylamino)ethoxy]ethyl]morpholin-2-yl]methyl]-2-methyl-2-propylpentan-1-amine |
|---|---|
| PubChem CID | 170039013 |
| Molecular Formula | C22H47N3O2 |
| Molecular Weight | 385.64 g/mol |
| Exact Mass | 385.37 |
| IUPAC Name | N-[[4-[2-[2-(tert-butylamino)ethoxy]ethyl]morpholin-2-yl]methyl]-2-methyl-2-propylpentan-1-amine |
| SMILES | CCCC(C)(CCC)CNCC1CN(CCOCCNC(C)(C)C)CCO1 |
| InChI | InChI=1S/C22H47N3O2/c1-7-9-22(6,10-8-2)19-23-17-20-18-25(13-16-27-20)12-15-26-14-11-24-21(3,4)5/h20,23-24H,7-19H2,1-6H3 |
| InChIKey | HVEVDQSOZCXERW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.64 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|