C12H15IN2 — CID 170043061
(1S,4S)-2-(4-iodophenyl)-5-methyl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 170043061) has the molecular formula C12H15IN2 and a molecular weight of 314.17 g/mol. Its IUPAC name is (1S,4S)-2-(4-iodophenyl)-5-methyl-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-2-(4-iodophenyl)-5-methyl-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 170043061 |
| Molecular Formula | C12H15IN2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | (1S,4S)-2-(4-iodophenyl)-5-methyl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CN1C[C@@H]2C[C@H]1CN2c1ccc(I)cc1 |
| InChI | InChI=1S/C12H15IN2/c1-14-7-12-6-11(14)8-15(12)10-4-2-9(13)3-5-10/h2-5,11-12H,6-8H2,1H3/t11-,12-/m0/s1 |
| InChIKey | MLLOELJZFRSMGT-RYUDHWBXSA-N |
| XLogP | 2.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|