C11H15FN4 — CID 146155963
2-fluoro-5-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyridin-3-amine (PubChem CID 146155963) has the molecular formula C11H15FN4 and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-fluoro-5-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyridin-3-amine.
| Compound Name | 2-fluoro-5-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 146155963 |
| Molecular Formula | C11H15FN4 |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-fluoro-5-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyridin-3-amine |
| SMILES | CN1C[C@@H]2C[C@H]1CN2c1cnc(F)c(N)c1 |
| InChI | InChI=1S/C11H15FN4/c1-15-5-9-2-8(15)6-16(9)7-3-10(13)11(12)14-4-7/h3-4,8-9H,2,5-6,13H2,1H3/t8-,9-/m0/s1 |
| InChIKey | CZFWTHFFWRUZTR-IUCAKERBSA-N |
| XLogP | 0.70 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|