About 3-[(1-imino-2-methylpropan-2-yl)diazenyl]-2,2-dimethylpropanenitrile
3-[(1-imino-2-methylpropan-2-yl)diazenyl]-2,2-dimethylpropanenitrile (PubChem CID 170049043) has the molecular formula C9H16N4
and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-[(1-imino-2-methylpropan-2-yl)diazenyl]-2,2-dimethylpropanenitrile.
Molecular Properties
| Compound Name | 3-[(1-imino-2-methylpropan-2-yl)diazenyl]-2,2-dimethylpropanenitrile |
| PubChem CID | 170049043 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 3-[(1-imino-2-methylpropan-2-yl)diazenyl]-2,2-dimethylpropanenitrile |
| SMILES | [H]/N=C/C(C)(C)/N=N/CC(C)(C)C#N |
| InChI | InChI=1S/C9H16N4/c1-8(2,5-10)7-12-13-9(3,4)6-11/h6,11H,7H2,1-4H3/b11-6+,13-12+ |
| InChIKey | DVIPWTMYDZHOIK-BPLLCVTGSA-N |
| XLogP | 2.42 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1-imino-2-methylpropan-2-yl)diazenyl]-2,2-dimethylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-imino-2-methylpropan-2-yl)diazenyl]-2,2-dimethylpropanenitrile?
The IUPAC name of 3-[(1-imino-2-methylpropan-2-yl)diazenyl]-2,2-dimethylpropanenitrile (CID 170049043) is 3-[(1-imino-2-methylpropan-2-yl)diazenyl]-2,2-dimethylpropanenitrile.
What is the SMILES notation for 3-[(1-imino-2-methylpropan-2-yl)diazenyl]-2,2-dimethylpropanenitrile?
The canonical SMILES for 3-[(1-imino-2-methylpropan-2-yl)diazenyl]-2,2-dimethylpropanenitrile is [H]/N=C/C(C)(C)/N=N/CC(C)(C)C#N.
What is the InChIKey of 3-[(1-imino-2-methylpropan-2-yl)diazenyl]-2,2-dimethylpropanenitrile?
The InChIKey is DVIPWTMYDZHOIK-BPLLCVTGSA-N. The full InChI is InChI=1S/C9H16N4/c1-8(2,5-10)7-12-13-9(3,4)6-11/h6,11H,7H2,1-4H3/b11-6+,13-12+.
What are the key properties of 3-[(1-imino-2-methylpropan-2-yl)diazenyl]-2,2-dimethylpropanenitrile?
3-[(1-imino-2-methylpropan-2-yl)diazenyl]-2,2-dimethylpropanenitrile has a molecular weight of 180.25 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-imino-2-methylpropan-2-yl)diazenyl]-2,2-dimethylpropanenitrile is sourced from PubChem (CID 170049043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).