C10H16N4 — CID 174779390
3-diazenyl-2,2,3,4,4-pentamethylpentanedinitrile (PubChem CID 174779390) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 3-diazenyl-2,2,3,4,4-pentamethylpentanedinitrile.
| Compound Name | 3-diazenyl-2,2,3,4,4-pentamethylpentanedinitrile |
|---|---|
| PubChem CID | 174779390 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 3-diazenyl-2,2,3,4,4-pentamethylpentanedinitrile |
| SMILES | [H]/N=N/C(C)(C(C)(C)C#N)C(C)(C)C#N |
| InChI | InChI=1S/C10H16N4/c1-8(2,6-11)10(5,14-13)9(3,4)7-12/h13H,1-5H3/b14-13+ |
| InChIKey | HCUNRDPMXRCJSF-BUHFOSPRSA-N |
| XLogP | 2.88 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|