C7H9N5O — CID 146520841
5,5-dicyano-5-diazenylpentanamide (PubChem CID 146520841) has the molecular formula C7H9N5O and a molecular weight of 179.18 g/mol. Its IUPAC name is 5,5-dicyano-5-diazenylpentanamide.
| Compound Name | 5,5-dicyano-5-diazenylpentanamide |
|---|---|
| PubChem CID | 146520841 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 5,5-dicyano-5-diazenylpentanamide |
| SMILES | [H]/N=N/C(C#N)(C#N)CCCC(N)=O |
| InChI | InChI=1S/C7H9N5O/c8-4-7(5-9,12-11)3-1-2-6(10)13/h11H,1-3H2,(H2,10,13)/b12-11+ |
| InChIKey | COFKOFCGPDKJQB-VAWYXSNFSA-N |
| XLogP | 0.46 |
| TPSA | 126.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|