C11H16N4O — CID 175022889
3-acetyl-3-diazenyl-2,2,4,4-tetramethylpentanedinitrile (PubChem CID 175022889) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 3-acetyl-3-diazenyl-2,2,4,4-tetramethylpentanedinitrile.
| Compound Name | 3-acetyl-3-diazenyl-2,2,4,4-tetramethylpentanedinitrile |
|---|---|
| PubChem CID | 175022889 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 3-acetyl-3-diazenyl-2,2,4,4-tetramethylpentanedinitrile |
| SMILES | [H]/N=N/C(C(C)=O)(C(C)(C)C#N)C(C)(C)C#N |
| InChI | InChI=1S/C11H16N4O/c1-8(16)11(15-14,9(2,3)6-12)10(4,5)7-13/h14H,1-5H3/b15-14+ |
| InChIKey | UWRUVAXZDHEKTK-CCEZHUSRSA-N |
| XLogP | 2.44 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|