C8H12N4 — CID 170160766
(2R)-2-diazenyl-2,4,4-trimethylpentanedinitrile (PubChem CID 170160766) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is (2R)-2-diazenyl-2,4,4-trimethylpentanedinitrile.
| Compound Name | (2R)-2-diazenyl-2,4,4-trimethylpentanedinitrile |
|---|---|
| PubChem CID | 170160766 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | (2R)-2-diazenyl-2,4,4-trimethylpentanedinitrile |
| SMILES | [H]/N=N/[C@@](C)(C#N)CC(C)(C)C#N |
| InChI | InChI=1S/C8H12N4/c1-7(2,5-9)4-8(3,6-10)12-11/h11H,4H2,1-3H3/b12-11+/t8-/m1/s1 |
| InChIKey | NUGMNEHHMGHXIK-MDBUJETNSA-N |
| XLogP | 2.24 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|