C20H21F2N5O2 — CID 170055048
4-[4-[[3-(1,1-difluoroethyl)-1-methylpyrazol-5-yl]oxymethyl]-2-pyridinyl]-2-methylbenzohydrazide (PubChem CID 170055048) has the molecular formula C20H21F2N5O2 and a molecular weight of 401.42 g/mol. Its IUPAC name is 4-[4-[[3-(1,1-difluoroethyl)-1-methylpyrazol-5-yl]oxymethyl]-2-pyridinyl]-2-methylbenzohydrazide.
| Compound Name | 4-[4-[[3-(1,1-difluoroethyl)-1-methylpyrazol-5-yl]oxymethyl]-2-pyridinyl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 170055048 |
| Molecular Formula | C20H21F2N5O2 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 4-[4-[[3-(1,1-difluoroethyl)-1-methylpyrazol-5-yl]oxymethyl]-2-pyridinyl]-2-methylbenzohydrazide |
| SMILES | Cc1cc(-c2cc(COc3cc(C(C)(F)F)nn3C)ccn2)ccc1C(=O)NN |
| InChI | InChI=1S/C20H21F2N5O2/c1-12-8-14(4-5-15(12)19(28)25-23)16-9-13(6-7-24-16)11-29-18-10-17(20(2,21)22)26-27(18)3/h4-10H,11,23H2,1-3H3,(H,25,28) |
| InChIKey | VZHPQGRQHIOMER-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|