C39H58N2O2 — CID 170057975
[(3S,8S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-amino-3-(1-methylindol-3-yl)propanoate (PubChem CID 170057975) has the molecular formula C39H58N2O2 and a molecular weight of 586.91 g/mol. Its IUPAC name is [(3S,8S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-amino-3-(1-methylindol-3-yl)propanoate.
| Compound Name | [(3S,8S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-amino-3-(1-methylindol-3-yl)propanoate |
|---|---|
| PubChem CID | 170057975 |
| Molecular Formula | C39H58N2O2 |
| Molecular Weight | 586.91 g/mol |
| Exact Mass | 586.45 |
| IUPAC Name | [(3S,8S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-amino-3-(1-methylindol-3-yl)propanoate |
| SMILES | CC(C)CCCC(C)C1CCC2[C@@H]3CC=C4C[C@@H](OC(=O)[C@@H](N)Cc5cn(C)c6ccccc56)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C39H58N2O2/c1-25(2)10-9-11-26(3)32-16-17-33-31-15-14-28-23-29(18-20-38(28,4)34(31)19-21-39(32,33)5)43-37(42)35(40)22-27-24-41(6)36-13-8-7-12-30(27)36/h7-8,12-14,24-26,29,31-35H,9-11,15-23,40H2,1-6H3/t26?,29-,31-,32?,33?,34?,35-,38-,39+/m0/s1 |
| InChIKey | DPXJWUYDGRXNOQ-BEBRPZIYSA-N |
| XLogP | 9.00 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.91 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|