C38H48N4O8 — CID 170061321
2-[4-[[2-[3-[3-(3,4-dimethoxyphenyl)propyl]phenoxy]acetyl]amino]butylamino]-N-(5-formamido-5-oxopentan-2-yl)-N-formyl-6-methylbenzamide (PubChem CID 170061321) has the molecular formula C38H48N4O8 and a molecular weight of 688.82 g/mol. Its IUPAC name is 2-[4-[[2-[3-[3-(3,4-dimethoxyphenyl)propyl]phenoxy]acetyl]amino]butylamino]-N-(5-formamido-5-oxopentan-2-yl)-N-formyl-6-methylbenzamide.
| Compound Name | 2-[4-[[2-[3-[3-(3,4-dimethoxyphenyl)propyl]phenoxy]acetyl]amino]butylamino]-N-(5-formamido-5-oxopentan-2-yl)-N-formyl-6-methylbenzamide |
|---|---|
| PubChem CID | 170061321 |
| Molecular Formula | C38H48N4O8 |
| Molecular Weight | 688.82 g/mol |
| Exact Mass | 688.35 |
| IUPAC Name | 2-[4-[[2-[3-[3-(3,4-dimethoxyphenyl)propyl]phenoxy]acetyl]amino]butylamino]-N-(5-formamido-5-oxopentan-2-yl)-N-formyl-6-methylbenzamide |
| SMILES | COc1ccc(CCCc2cccc(OCC(=O)NCCCCNc3cccc(C)c3C(=O)N(C=O)C(C)CCC(=O)NC=O)c2)cc1OC |
| InChI | InChI=1S/C38H48N4O8/c1-27-10-7-15-32(37(27)38(47)42(26-44)28(2)16-19-35(45)41-25-43)39-20-5-6-21-40-36(46)24-50-31-14-9-13-29(22-31)11-8-12-30-17-18-33(48-3)34(23-30)49-4/h7,9-10,13-15,17-18,22-23,25-26,28,39H,5-6,8,11-12,16,19-21,24H2,1-4H3,(H,40,46)(H,41,43,45) |
| InChIKey | JLFKQQYIAIDUPL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 152.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.82 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|