C33H40FN5O7S — CID 170069548
[2-[2-[6-(4-acetylsulfanylbutanoylamino)-2-fluoropurin-9-yl]ethyl]-2-methoxybut-3-ynyl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate (PubChem CID 170069548) has the molecular formula C33H40FN5O7S and a molecular weight of 669.78 g/mol. Its IUPAC name is [2-[2-[6-(4-acetylsulfanylbutanoylamino)-2-fluoropurin-9-yl]ethyl]-2-methoxybut-3-ynyl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate.
| Compound Name | [2-[2-[6-(4-acetylsulfanylbutanoylamino)-2-fluoropurin-9-yl]ethyl]-2-methoxybut-3-ynyl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 170069548 |
| Molecular Formula | C33H40FN5O7S |
| Molecular Weight | 669.78 g/mol |
| Exact Mass | 669.26 |
| IUPAC Name | [2-[2-[6-(4-acetylsulfanylbutanoylamino)-2-fluoropurin-9-yl]ethyl]-2-methoxybut-3-ynyl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
| SMILES | C#CC(CCn1cnc2c(NC(=O)CCCSC(C)=O)nc(F)nc21)(COC(=O)CC(C)(C)c1c(C)cc(C)cc1OC(C)=O)OC |
| InChI | InChI=1S/C33H40FN5O7S/c1-9-33(44-8,18-45-26(43)17-32(6,7)27-21(3)15-20(2)16-24(27)46-22(4)40)12-13-39-19-35-28-29(37-31(34)38-30(28)39)36-25(42)11-10-14-47-23(5)41/h1,15-16,19H,10-14,17-18H2,2-8H3,(H,36,37,38,42) |
| InChIKey | RSSGTUBOYSSRAF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 151.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.78 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|