C30H36FN5O6 — CID 170069778
[2-[[2-fluoro-9-[(3R)-3-methoxy-3-(2-methylpropanoyloxymethyl)pent-4-ynyl]purin-6-yl]carbamoyl]phenyl]methyl hexanoate (PubChem CID 170069778) has the molecular formula C30H36FN5O6 and a molecular weight of 581.65 g/mol. Its IUPAC name is [2-[[2-fluoro-9-[(3R)-3-methoxy-3-(2-methylpropanoyloxymethyl)pent-4-ynyl]purin-6-yl]carbamoyl]phenyl]methyl hexanoate.
| Compound Name | [2-[[2-fluoro-9-[(3R)-3-methoxy-3-(2-methylpropanoyloxymethyl)pent-4-ynyl]purin-6-yl]carbamoyl]phenyl]methyl hexanoate |
|---|---|
| PubChem CID | 170069778 |
| Molecular Formula | C30H36FN5O6 |
| Molecular Weight | 581.65 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | [2-[[2-fluoro-9-[(3R)-3-methoxy-3-(2-methylpropanoyloxymethyl)pent-4-ynyl]purin-6-yl]carbamoyl]phenyl]methyl hexanoate |
| SMILES | C#C[C@](CCn1cnc2c(NC(=O)c3ccccc3COC(=O)CCCCC)nc(F)nc21)(COC(=O)C(C)C)OC |
| InChI | InChI=1S/C30H36FN5O6/c1-6-8-9-14-23(37)41-17-21-12-10-11-13-22(21)27(38)33-25-24-26(35-29(31)34-25)36(19-32-24)16-15-30(7-2,40-5)18-42-28(39)20(3)4/h2,10-13,19-20H,6,8-9,14-18H2,1,3-5H3,(H,33,34,35,38)/t30-/m0/s1 |
| InChIKey | HBDNBNLEPBDHPR-PMERELPUSA-N |
| XLogP | 4.45 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.65 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|