C35H46FN5O7 — CID 170069735
[2-[(1S)-2-[2-fluoro-6-(octanoylamino)purin-9-yl]-1-hydroxyethyl]-2-methoxybut-3-ynyl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate (PubChem CID 170069735) has the molecular formula C35H46FN5O7 and a molecular weight of 667.78 g/mol. Its IUPAC name is [2-[(1S)-2-[2-fluoro-6-(octanoylamino)purin-9-yl]-1-hydroxyethyl]-2-methoxybut-3-ynyl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate.
| Compound Name | [2-[(1S)-2-[2-fluoro-6-(octanoylamino)purin-9-yl]-1-hydroxyethyl]-2-methoxybut-3-ynyl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 170069735 |
| Molecular Formula | C35H46FN5O7 |
| Molecular Weight | 667.78 g/mol |
| Exact Mass | 667.34 |
| IUPAC Name | [2-[(1S)-2-[2-fluoro-6-(octanoylamino)purin-9-yl]-1-hydroxyethyl]-2-methoxybut-3-ynyl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
| SMILES | C#CC(COC(=O)CC(C)(C)c1c(C)cc(C)cc1OC(C)=O)(OC)[C@@H](O)Cn1cnc2c(NC(=O)CCCCCCC)nc(F)nc21 |
| InChI | InChI=1S/C35H46FN5O7/c1-9-11-12-13-14-15-27(44)38-31-30-32(40-33(36)39-31)41(21-37-30)19-26(43)35(10-2,46-8)20-47-28(45)18-34(6,7)29-23(4)16-22(3)17-25(29)48-24(5)42/h2,16-17,21,26,43H,9,11-15,18-20H2,1,3-8H3,(H,38,39,40,44)/t26-,35?/m0/s1 |
| InChIKey | JPCCUUTWAWNSKB-HJYWNDIWSA-N |
| XLogP | 5.10 |
| TPSA | 154.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.78 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|