C19H26FN5O4 — CID 146369379
[(2S)-1-(6-amino-2-fluoropurin-9-yl)-3-(hydroxymethyl)-3-methoxypent-4-yn-2-yl] heptanoate (PubChem CID 146369379) has the molecular formula C19H26FN5O4 and a molecular weight of 407.45 g/mol. Its IUPAC name is [(2S)-1-(6-amino-2-fluoropurin-9-yl)-3-(hydroxymethyl)-3-methoxypent-4-yn-2-yl] heptanoate.
| Compound Name | [(2S)-1-(6-amino-2-fluoropurin-9-yl)-3-(hydroxymethyl)-3-methoxypent-4-yn-2-yl] heptanoate |
|---|---|
| PubChem CID | 146369379 |
| Molecular Formula | C19H26FN5O4 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | [(2S)-1-(6-amino-2-fluoropurin-9-yl)-3-(hydroxymethyl)-3-methoxypent-4-yn-2-yl] heptanoate |
| SMILES | C#CC(CO)(OC)[C@H](Cn1cnc2c(N)nc(F)nc21)OC(=O)CCCCCC |
| InChI | InChI=1S/C19H26FN5O4/c1-4-6-7-8-9-14(27)29-13(19(5-2,11-26)28-3)10-25-12-22-15-16(21)23-18(20)24-17(15)25/h2,12-13,26H,4,6-11H2,1,3H3,(H2,21,23,24)/t13-,19?/m0/s1 |
| InChIKey | MFAYKMDUVJVDJJ-YTJLLHSVSA-N |
| XLogP | 1.44 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|