C27H32FN5O6 — CID 170069364
[(2S,3R)-1-(6-amino-2-fluoropurin-9-yl)-3-(hydroxymethyl)-3-methoxypent-4-yn-2-yl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate (PubChem CID 170069364) has the molecular formula C27H32FN5O6 and a molecular weight of 541.58 g/mol. Its IUPAC name is [(2S,3R)-1-(6-amino-2-fluoropurin-9-yl)-3-(hydroxymethyl)-3-methoxypent-4-yn-2-yl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate.
| Compound Name | [(2S,3R)-1-(6-amino-2-fluoropurin-9-yl)-3-(hydroxymethyl)-3-methoxypent-4-yn-2-yl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 170069364 |
| Molecular Formula | C27H32FN5O6 |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | [(2S,3R)-1-(6-amino-2-fluoropurin-9-yl)-3-(hydroxymethyl)-3-methoxypent-4-yn-2-yl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
| SMILES | C#C[C@](CO)(OC)[C@H](Cn1cnc2c(N)nc(F)nc21)OC(=O)CC(C)(C)c1c(C)cc(C)cc1OC(C)=O |
| InChI | InChI=1S/C27H32FN5O6/c1-8-27(13-34,37-7)19(12-33-14-30-22-23(29)31-25(28)32-24(22)33)39-20(36)11-26(5,6)21-16(3)9-15(2)10-18(21)38-17(4)35/h1,9-10,14,19,34H,11-13H2,2-7H3,(H2,29,31,32)/t19-,27+/m0/s1 |
| InChIKey | SXGZUGBHWPJGNT-UZTOHYMASA-N |
| XLogP | 2.38 |
| TPSA | 151.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|