C19H26FN5O4 — CID 167019984
[(2S)-1-(6-amino-2-fluoropurin-9-yl)-3-(hydroxymethyl)-3-methoxypent-4-yn-2-yl] 2,2-dimethylpentanoate (PubChem CID 167019984) has the molecular formula C19H26FN5O4 and a molecular weight of 407.45 g/mol. Its IUPAC name is [(2S)-1-(6-amino-2-fluoropurin-9-yl)-3-(hydroxymethyl)-3-methoxypent-4-yn-2-yl] 2,2-dimethylpentanoate.
| Compound Name | [(2S)-1-(6-amino-2-fluoropurin-9-yl)-3-(hydroxymethyl)-3-methoxypent-4-yn-2-yl] 2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 167019984 |
| Molecular Formula | C19H26FN5O4 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | [(2S)-1-(6-amino-2-fluoropurin-9-yl)-3-(hydroxymethyl)-3-methoxypent-4-yn-2-yl] 2,2-dimethylpentanoate |
| SMILES | C#CC(CO)(OC)[C@H](Cn1cnc2c(N)nc(F)nc21)OC(=O)C(C)(C)CCC |
| InChI | InChI=1S/C19H26FN5O4/c1-6-8-18(3,4)16(27)29-12(19(7-2,10-26)28-5)9-25-11-22-13-14(21)23-17(20)24-15(13)25/h2,11-12,26H,6,8-10H2,1,3-5H3,(H2,21,23,24)/t12-,19?/m0/s1 |
| InChIKey | FWNSOIHTXCHKLJ-HSLMYDHPSA-N |
| XLogP | 1.30 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|