C10H10Cl3FN6O2 — CID 155539118
ethyl N-[1-(6-amino-2-fluoropurin-9-yl)-2,2,2-trichloroethyl]carbamate (PubChem CID 155539118) has the molecular formula C10H10Cl3FN6O2 and a molecular weight of 371.59 g/mol. Its IUPAC name is ethyl N-[1-(6-amino-2-fluoropurin-9-yl)-2,2,2-trichloroethyl]carbamate.
| Compound Name | ethyl N-[1-(6-amino-2-fluoropurin-9-yl)-2,2,2-trichloroethyl]carbamate |
|---|---|
| PubChem CID | 155539118 |
| Molecular Formula | C10H10Cl3FN6O2 |
| Molecular Weight | 371.59 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | ethyl N-[1-(6-amino-2-fluoropurin-9-yl)-2,2,2-trichloroethyl]carbamate |
| SMILES | CCOC(=O)NC(n1cnc2c(N)nc(F)nc21)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H10Cl3FN6O2/c1-2-22-9(21)19-7(10(11,12)13)20-3-16-4-5(15)17-8(14)18-6(4)20/h3,7H,2H2,1H3,(H,19,21)(H2,15,17,18) |
| InChIKey | HSYZXYNDSYNIDR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.59 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|