C12H18FN5O3 — CID 166922439
5-(6-amino-2-fluoropurin-9-yl)-4-methoxyhexane-2,3-diol (PubChem CID 166922439) has the molecular formula C12H18FN5O3 and a molecular weight of 299.31 g/mol. Its IUPAC name is 5-(6-amino-2-fluoropurin-9-yl)-4-methoxyhexane-2,3-diol.
| Compound Name | 5-(6-amino-2-fluoropurin-9-yl)-4-methoxyhexane-2,3-diol |
|---|---|
| PubChem CID | 166922439 |
| Molecular Formula | C12H18FN5O3 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 5-(6-amino-2-fluoropurin-9-yl)-4-methoxyhexane-2,3-diol |
| SMILES | COC(C(O)C(C)O)C(C)n1cnc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C12H18FN5O3/c1-5(9(21-3)8(20)6(2)19)18-4-15-7-10(14)16-12(13)17-11(7)18/h4-6,8-9,19-20H,1-3H3,(H2,14,16,17) |
| InChIKey | GXGGADYOIUDCKR-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |