C15H20FN5 — CID 70880252
9-[(5R)-4-butan-2-yl-5-methylcyclopenten-1-yl]-2-fluoropurin-6-amine (PubChem CID 70880252) has the molecular formula C15H20FN5 and a molecular weight of 289.36 g/mol. Its IUPAC name is 9-[(5R)-4-butan-2-yl-5-methylcyclopenten-1-yl]-2-fluoropurin-6-amine.
| Compound Name | 9-[(5R)-4-butan-2-yl-5-methylcyclopenten-1-yl]-2-fluoropurin-6-amine |
|---|---|
| PubChem CID | 70880252 |
| Molecular Formula | C15H20FN5 |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 9-[(5R)-4-butan-2-yl-5-methylcyclopenten-1-yl]-2-fluoropurin-6-amine |
| SMILES | CCC(C)C1CC=C(n2cnc3c(N)nc(F)nc32)[C@@H]1C |
| InChI | InChI=1S/C15H20FN5/c1-4-8(2)10-5-6-11(9(10)3)21-7-18-12-13(17)19-15(16)20-14(12)21/h6-10H,4-5H2,1-3H3,(H2,17,19,20)/t8?,9-,10?/m1/s1 |
| InChIKey | YLWGEXRLYVQYGB-HWOCKDDLSA-N |
| XLogP | 3.09 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |