C27H34FN6O7P — CID 170069402
cyclohexyl (2S)-2-[[[(2R)-2-[(1S)-2-(6-amino-2-fluoropurin-9-yl)-1-hydroxyethyl]-2-methoxybut-3-ynoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 170069402) has the molecular formula C27H34FN6O7P and a molecular weight of 604.58 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2R)-2-[(1S)-2-(6-amino-2-fluoropurin-9-yl)-1-hydroxyethyl]-2-methoxybut-3-ynoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2R)-2-[(1S)-2-(6-amino-2-fluoropurin-9-yl)-1-hydroxyethyl]-2-methoxybut-3-ynoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170069402 |
| Molecular Formula | C27H34FN6O7P |
| Molecular Weight | 604.58 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2R)-2-[(1S)-2-(6-amino-2-fluoropurin-9-yl)-1-hydroxyethyl]-2-methoxybut-3-ynoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@](COP(=O)(N[C@@H](C)C(=O)OC1CCCCC1)Oc1ccccc1)(OC)[C@@H](O)Cn1cnc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C27H34FN6O7P/c1-4-27(38-3,21(35)15-34-17-30-22-23(29)31-26(28)32-24(22)34)16-39-42(37,41-20-13-9-6-10-14-20)33-18(2)25(36)40-19-11-7-5-8-12-19/h1,6,9-10,13-14,17-19,21,35H,5,7-8,11-12,15-16H2,2-3H3,(H,33,37)(H2,29,31,32)/t18-,21-,27+,42?/m0/s1 |
| InChIKey | KJVGNBCPNTUAJL-XITOXDLESA-N |
| XLogP | 2.98 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|