C29H42FN6O9P — CID 144828789
(2-amino-6-ethoxypurin-9-yl)methanol;cyclohexyl 2-[[[(2S,3S)-2-fluoro-2,3-dihydroxyhex-4-enoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 144828789) has the molecular formula C29H42FN6O9P and a molecular weight of 668.66 g/mol. Its IUPAC name is (2-amino-6-ethoxypurin-9-yl)methanol;cyclohexyl 2-[[[(2S,3S)-2-fluoro-2,3-dihydroxyhex-4-enoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | (2-amino-6-ethoxypurin-9-yl)methanol;cyclohexyl 2-[[[(2S,3S)-2-fluoro-2,3-dihydroxyhex-4-enoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144828789 |
| Molecular Formula | C29H42FN6O9P |
| Molecular Weight | 668.66 g/mol |
| Exact Mass | 668.27 |
| IUPAC Name | (2-amino-6-ethoxypurin-9-yl)methanol;cyclohexyl 2-[[[(2S,3S)-2-fluoro-2,3-dihydroxyhex-4-enoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC=C[C@H](O)[C@@](O)(F)COP(=O)(NC(C)C(=O)OC1CCCCC1)Oc1ccccc1.CCOc1nc(N)nc2c1ncn2CO |
| InChI | InChI=1S/C21H31FNO7P.C8H11N5O2/c1-3-10-19(24)21(22,26)15-28-31(27,30-18-13-8-5-9-14-18)23-16(2)20(25)29-17-11-6-4-7-12-17;1-2-15-7-5-6(11-8(9)12-7)13(4-14)3-10-5/h3,5,8-10,13-14,16-17,19,24,26H,4,6-7,11-12,15H2,1-2H3,(H,23,27);3,14H,2,4H2,1H3,(H2,9,11,12)/t16?,19-,21+,31?;/m0./s1 |
| InChIKey | SXFIXGARAOHMMU-FXAOLVHASA-N |
| XLogP | 3.40 |
| TPSA | 213.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.66 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|