C28H39F2N6O8P — CID 144654123
cyclohexyl 2-[[[(2S,3S,4R)-4-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-2-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 144654123) has the molecular formula C28H39F2N6O8P and a molecular weight of 656.62 g/mol. Its IUPAC name is cyclohexyl 2-[[[(2S,3S,4R)-4-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-2-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[(2S,3S,4R)-4-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-2-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144654123 |
| Molecular Formula | C28H39F2N6O8P |
| Molecular Weight | 656.62 g/mol |
| Exact Mass | 656.25 |
| IUPAC Name | cyclohexyl 2-[[[(2S,3S,4R)-4-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-2-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@](C)(F)[C@H](O)[C@@](F)(COP(=O)(NC(C)C(=O)OC1CCCCC1)Oc1ccccc1)OC |
| InChI | InChI=1S/C28H39F2N6O8P/c1-5-41-23-21-22(33-26(31)34-23)36(17-32-21)27(3,29)25(38)28(30,40-4)16-42-45(39,44-20-14-10-7-11-15-20)35-18(2)24(37)43-19-12-8-6-9-13-19/h7,10-11,14-15,17-19,25,38H,5-6,8-9,12-13,16H2,1-4H3,(H,35,39)(H2,31,33,34)/t18?,25-,27-,28+,45?/m0/s1 |
| InChIKey | GAXKCSPBLLEMQD-CDXVYULRSA-N |
| XLogP | 4.18 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|