C26H35F2N6O8P — CID 144766856
cyclohexyl 2-[[[(2S,3S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2,3-difluoro-4-hydroxy-2-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 144766856) has the molecular formula C26H35F2N6O8P and a molecular weight of 628.57 g/mol. Its IUPAC name is cyclohexyl 2-[[[(2S,3S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2,3-difluoro-4-hydroxy-2-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[(2S,3S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2,3-difluoro-4-hydroxy-2-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144766856 |
| Molecular Formula | C26H35F2N6O8P |
| Molecular Weight | 628.57 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | cyclohexyl 2-[[[(2S,3S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2,3-difluoro-4-hydroxy-2-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CO[C@](F)(COP(=O)(NC(C)C(=O)OC1CCCCC1)Oc1ccccc1)[C@@H](F)[C@@](C)(O)n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C26H35F2N6O8P/c1-16(22(36)41-17-10-6-4-7-11-17)33-43(38,42-18-12-8-5-9-13-18)40-14-26(28,39-3)23(27)25(2,37)34-15-30-19-20(34)31-24(29)32-21(19)35/h5,8-9,12-13,15-17,23,37H,4,6-7,10-11,14H2,1-3H3,(H,33,38)(H3,29,31,32,35)/t16?,23-,25+,26+,43?/m0/s1 |
| InChIKey | BDPSNBHNLUYUEH-IUTULTJRSA-N |
| XLogP | 3.07 |
| TPSA | 192.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|