C30H40F2N7O8P — CID 118596022
2,2-dimethylpropyl 2-[[[(2S,3S,4R)-4-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-2-methoxypentoxy]-quinolin-5-yloxyphosphoryl]amino]propanoate (PubChem CID 118596022) has the molecular formula C30H40F2N7O8P and a molecular weight of 695.66 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-[[[(2S,3S,4R)-4-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-2-methoxypentoxy]-quinolin-5-yloxyphosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl 2-[[[(2S,3S,4R)-4-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-2-methoxypentoxy]-quinolin-5-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118596022 |
| Molecular Formula | C30H40F2N7O8P |
| Molecular Weight | 695.66 g/mol |
| Exact Mass | 695.26 |
| IUPAC Name | 2,2-dimethylpropyl 2-[[[(2S,3S,4R)-4-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-2-methoxypentoxy]-quinolin-5-yloxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@](C)(F)[C@H](O)[C@@](F)(COP(=O)(NC(C)C(=O)OCC(C)(C)C)Oc1cccc2ncccc12)OC |
| InChI | InChI=1S/C30H40F2N7O8P/c1-8-44-24-22-23(36-27(33)37-24)39(17-35-22)29(6,31)26(41)30(32,43-7)16-46-48(42,38-18(2)25(40)45-15-28(3,4)5)47-21-13-9-12-20-19(21)11-10-14-34-20/h9-14,17-18,26,41H,8,15-16H2,1-7H3,(H,38,42)(H2,33,36,37)/t18?,26-,29-,30+,48?/m0/s1 |
| InChIKey | WIAZKOOSOLGOHY-RHEVIHHCSA-N |
| XLogP | 4.44 |
| TPSA | 195.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|