C27H30FN5O6 — CID 175119167
3-(2-acetyloxy-4,6-dimethylphenyl)-2-[(3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl]-3-methylbutanoic acid (PubChem CID 175119167) has the molecular formula C27H30FN5O6 and a molecular weight of 539.56 g/mol. Its IUPAC name is 3-(2-acetyloxy-4,6-dimethylphenyl)-2-[(3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl]-3-methylbutanoic acid.
| Compound Name | 3-(2-acetyloxy-4,6-dimethylphenyl)-2-[(3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 175119167 |
| Molecular Formula | C27H30FN5O6 |
| Molecular Weight | 539.56 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 3-(2-acetyloxy-4,6-dimethylphenyl)-2-[(3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl]-3-methylbutanoic acid |
| SMILES | C#CC1(CO)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@H]1C(C(=O)O)C(C)(C)c1c(C)cc(C)cc1OC(C)=O |
| InChI | InChI=1S/C27H30FN5O6/c1-7-27(11-34)16(10-18(39-27)33-12-30-21-22(29)31-25(28)32-23(21)33)20(24(36)37)26(5,6)19-14(3)8-13(2)9-17(19)38-15(4)35/h1,8-9,12,16,18,20,34H,10-11H2,2-6H3,(H,36,37)(H2,29,31,32)/t16-,18+,20?,27?/m0/s1 |
| InChIKey | GBQAEJIXVYBDET-CGNYWPHUSA-N |
| XLogP | 2.67 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|