C11H17N3O4 — CID 170073789
[(3-carbamoylbicyclo[1.1.1]pentane-1-carbonyl)amino] N-propan-2-ylcarbamate (PubChem CID 170073789) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is [(3-carbamoylbicyclo[1.1.1]pentane-1-carbonyl)amino] N-propan-2-ylcarbamate.
| Compound Name | [(3-carbamoylbicyclo[1.1.1]pentane-1-carbonyl)amino] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 170073789 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | [(3-carbamoylbicyclo[1.1.1]pentane-1-carbonyl)amino] N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)ONC(=O)C12CC(C(N)=O)(C1)C2 |
| InChI | InChI=1S/C11H17N3O4/c1-6(2)13-9(17)18-14-8(16)11-3-10(4-11,5-11)7(12)15/h6H,3-5H2,1-2H3,(H2,12,15)(H,13,17)(H,14,16) |
| InChIKey | YNNYFQJAGMUGJY-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|