C9H15NO2S — CID 167135234
3-hydroxy-N-[(1S)-1-methylsulfanylethyl]bicyclo[1.1.1]pentane-1-carboxamide (PubChem CID 167135234) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is 3-hydroxy-N-[(1S)-1-methylsulfanylethyl]bicyclo[1.1.1]pentane-1-carboxamide.
| Compound Name | 3-hydroxy-N-[(1S)-1-methylsulfanylethyl]bicyclo[1.1.1]pentane-1-carboxamide |
|---|---|
| PubChem CID | 167135234 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 3-hydroxy-N-[(1S)-1-methylsulfanylethyl]bicyclo[1.1.1]pentane-1-carboxamide |
| SMILES | CS[C@@H](C)NC(=O)C12CC(O)(C1)C2 |
| InChI | InChI=1S/C9H15NO2S/c1-6(13-2)10-7(11)8-3-9(12,4-8)5-8/h6,12H,3-5H2,1-2H3,(H,10,11)/t6-,8?,9?/m0/s1 |
| InChIKey | QAWPMQHOYPLHNB-GVWIPJJGSA-N |
| XLogP | 0.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|