C23H23NO3S — CID 170076797
(E)-1-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-6-methoxy-5-methylhex-3-en-2-one (PubChem CID 170076797) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is (E)-1-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-6-methoxy-5-methylhex-3-en-2-one.
| Compound Name | (E)-1-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-6-methoxy-5-methylhex-3-en-2-one |
|---|---|
| PubChem CID | 170076797 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (E)-1-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-6-methoxy-5-methylhex-3-en-2-one |
| SMILES | COCC(C)/C=C/C(=O)CSc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C23H23NO3S/c1-17(15-26-2)13-14-20(25)16-28-23-24-21(18-9-5-3-6-10-18)22(27-23)19-11-7-4-8-12-19/h3-14,17H,15-16H2,1-2H3/b14-13+ |
| InChIKey | FXTZDJSNEOCFJR-BUHFOSPRSA-N |
| XLogP | 5.51 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|