About 1-(2-fluoro-3-pyridinyl)ethyl N-[5-(5-amino-2-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate
1-(2-fluoro-3-pyridinyl)ethyl N-[5-(5-amino-2-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate (PubChem CID 170081448) has the molecular formula C17H16FN5O3
and a molecular weight of 357.35 g/mol. Its IUPAC name is 1-(2-fluoro-3-pyridinyl)ethyl N-[5-(5-amino-2-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate.
Molecular Properties
| Compound Name | 1-(2-fluoro-3-pyridinyl)ethyl N-[5-(5-amino-2-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate |
| PubChem CID | 170081448 |
| Molecular Formula | C17H16FN5O3 |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 1-(2-fluoro-3-pyridinyl)ethyl N-[5-(5-amino-2-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate |
| SMILES | Cc1noc(-c2ccc(N)cn2)c1NC(=O)OC(C)c1cccnc1F |
| InChI | InChI=1S/C17H16FN5O3/c1-9-14(15(26-23-9)13-6-5-11(19)8-21-13)22-17(24)25-10(2)12-4-3-7-20-16(12)18/h3-8,10H,19H2,1-2H3,(H,22,24) |
| InChIKey | KVNZRJOIOHBSDJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 116.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-fluoro-3-pyridinyl)ethyl N-[5-(5-amino-2-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluoro-3-pyridinyl)ethyl N-[5-(5-amino-2-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate?
The IUPAC name of 1-(2-fluoro-3-pyridinyl)ethyl N-[5-(5-amino-2-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate (CID 170081448) is 1-(2-fluoro-3-pyridinyl)ethyl N-[5-(5-amino-2-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate.
What is the SMILES notation for 1-(2-fluoro-3-pyridinyl)ethyl N-[5-(5-amino-2-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate?
The canonical SMILES for 1-(2-fluoro-3-pyridinyl)ethyl N-[5-(5-amino-2-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate is Cc1noc(-c2ccc(N)cn2)c1NC(=O)OC(C)c1cccnc1F.
What is the InChIKey of 1-(2-fluoro-3-pyridinyl)ethyl N-[5-(5-amino-2-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate?
The InChIKey is KVNZRJOIOHBSDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FN5O3/c1-9-14(15(26-23-9)13-6-5-11(19)8-21-13)22-17(24)25-10(2)12-4-3-7-20-16(12)18/h3-8,10H,19H2,1-2H3,(H,22,24).
What are the key properties of 1-(2-fluoro-3-pyridinyl)ethyl N-[5-(5-amino-2-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate?
1-(2-fluoro-3-pyridinyl)ethyl N-[5-(5-amino-2-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate has a molecular weight of 357.35 g/mol, XLogP of 3.47, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoro-3-pyridinyl)ethyl N-[5-(5-amino-2-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate is sourced from PubChem (CID 170081448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).