C24H27BFN3O5 — CID 70875834
[(1R)-1-(2-fluorophenyl)ethyl] N-[3-methyl-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,2-oxazol-4-yl]carbamate (PubChem CID 70875834) has the molecular formula C24H27BFN3O5 and a molecular weight of 467.31 g/mol. Its IUPAC name is [(1R)-1-(2-fluorophenyl)ethyl] N-[3-methyl-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,2-oxazol-4-yl]carbamate.
| Compound Name | [(1R)-1-(2-fluorophenyl)ethyl] N-[3-methyl-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,2-oxazol-4-yl]carbamate |
|---|---|
| PubChem CID | 70875834 |
| Molecular Formula | C24H27BFN3O5 |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | [(1R)-1-(2-fluorophenyl)ethyl] N-[3-methyl-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,2-oxazol-4-yl]carbamate |
| SMILES | Cc1noc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cn2)c1NC(=O)O[C@H](C)c1ccccc1F |
| InChI | InChI=1S/C24H27BFN3O5/c1-14-20(28-22(30)31-15(2)17-9-7-8-10-18(17)26)21(32-29-14)19-12-11-16(13-27-19)25-33-23(3,4)24(5,6)34-25/h7-13,15H,1-6H3,(H,28,30)/t15-/m1/s1 |
| InChIKey | PUPSATLTXFULKL-OAHLLOKOSA-N |
| XLogP | 4.79 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|