C25H29NO5 — CID 170085611
(3-ethenyl-4-methoxyphenyl) 4-[6-(prop-2-enoylamino)hexoxy]benzoate (PubChem CID 170085611) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is (3-ethenyl-4-methoxyphenyl) 4-[6-(prop-2-enoylamino)hexoxy]benzoate.
| Compound Name | (3-ethenyl-4-methoxyphenyl) 4-[6-(prop-2-enoylamino)hexoxy]benzoate |
|---|---|
| PubChem CID | 170085611 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (3-ethenyl-4-methoxyphenyl) 4-[6-(prop-2-enoylamino)hexoxy]benzoate |
| SMILES | C=CC(=O)NCCCCCCOc1ccc(C(=O)Oc2ccc(OC)c(C=C)c2)cc1 |
| InChI | InChI=1S/C25H29NO5/c1-4-19-18-22(14-15-23(19)29-3)31-25(28)20-10-12-21(13-11-20)30-17-9-7-6-8-16-26-24(27)5-2/h4-5,10-15,18H,1-2,6-9,16-17H2,3H3,(H,26,27) |
| InChIKey | UFZFZZKCOSSXBT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|