C13H14ClFN4O5S2 — CID 170092063
tert-butyl N-[2-chloro-5-fluoro-4-(1,2,4-thiadiazol-5-ylsulfamoyl)phenyl]-N-hydroxycarbamate (PubChem CID 170092063) has the molecular formula C13H14ClFN4O5S2 and a molecular weight of 424.86 g/mol. Its IUPAC name is tert-butyl N-[2-chloro-5-fluoro-4-(1,2,4-thiadiazol-5-ylsulfamoyl)phenyl]-N-hydroxycarbamate.
| Compound Name | tert-butyl N-[2-chloro-5-fluoro-4-(1,2,4-thiadiazol-5-ylsulfamoyl)phenyl]-N-hydroxycarbamate |
|---|---|
| PubChem CID | 170092063 |
| Molecular Formula | C13H14ClFN4O5S2 |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | tert-butyl N-[2-chloro-5-fluoro-4-(1,2,4-thiadiazol-5-ylsulfamoyl)phenyl]-N-hydroxycarbamate |
| SMILES | CC(C)(C)OC(=O)N(O)c1cc(F)c(S(=O)(=O)Nc2ncns2)cc1Cl |
| InChI | InChI=1S/C13H14ClFN4O5S2/c1-13(2,3)24-12(20)19(21)9-5-8(15)10(4-7(9)14)26(22,23)18-11-16-6-17-25-11/h4-6,21H,1-3H3,(H,16,17,18) |
| InChIKey | AWIAKYACYDVZAU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|