C19H19ClFN5O4S2 — CID 123250626
2-[3-[2-[2-chloro-5-fluoro-4-(1,2,4-thiadiazol-5-ylsulfamoyl)phenoxy]phenyl]propylamino]acetamide (PubChem CID 123250626) has the molecular formula C19H19ClFN5O4S2 and a molecular weight of 499.98 g/mol. Its IUPAC name is 2-[3-[2-[2-chloro-5-fluoro-4-(1,2,4-thiadiazol-5-ylsulfamoyl)phenoxy]phenyl]propylamino]acetamide.
| Compound Name | 2-[3-[2-[2-chloro-5-fluoro-4-(1,2,4-thiadiazol-5-ylsulfamoyl)phenoxy]phenyl]propylamino]acetamide |
|---|---|
| PubChem CID | 123250626 |
| Molecular Formula | C19H19ClFN5O4S2 |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 2-[3-[2-[2-chloro-5-fluoro-4-(1,2,4-thiadiazol-5-ylsulfamoyl)phenoxy]phenyl]propylamino]acetamide |
| SMILES | NC(=O)CNCCCc1ccccc1Oc1cc(F)c(S(=O)(=O)Nc2ncns2)cc1Cl |
| InChI | InChI=1S/C19H19ClFN5O4S2/c20-13-8-17(32(28,29)26-19-24-11-25-31-19)14(21)9-16(13)30-15-6-2-1-4-12(15)5-3-7-23-10-18(22)27/h1-2,4,6,8-9,11,23H,3,5,7,10H2,(H2,22,27)(H,24,25,26) |
| InChIKey | DBYZHZVXXHEKDZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|