C13H12F4N2 — CID 170104415
3-fluoro-N',4-dimethyl-N-(1,1,1-trifluorobut-3-en-2-ylidene)benzenecarboximidamide (PubChem CID 170104415) has the molecular formula C13H12F4N2 and a molecular weight of 272.25 g/mol. Its IUPAC name is 3-fluoro-N',4-dimethyl-N-(1,1,1-trifluorobut-3-en-2-ylidene)benzenecarboximidamide.
| Compound Name | 3-fluoro-N',4-dimethyl-N-(1,1,1-trifluorobut-3-en-2-ylidene)benzenecarboximidamide |
|---|---|
| PubChem CID | 170104415 |
| Molecular Formula | C13H12F4N2 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 3-fluoro-N',4-dimethyl-N-(1,1,1-trifluorobut-3-en-2-ylidene)benzenecarboximidamide |
| SMILES | C=C/C(=N\C(=N/C)c1ccc(C)c(F)c1)C(F)(F)F |
| InChI | InChI=1S/C13H12F4N2/c1-4-11(13(15,16)17)19-12(18-3)9-6-5-8(2)10(14)7-9/h4-7H,1H2,2-3H3/b18-12-,19-11+ |
| InChIKey | OGBCTMOYCIYKJH-LQVVDUSASA-N |
| XLogP | 3.70 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|