C13H14FNO — CID 91060927
methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate (PubChem CID 91060927) has the molecular formula C13H14FNO and a molecular weight of 219.26 g/mol. Its IUPAC name is methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate.
| Compound Name | methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate |
|---|---|
| PubChem CID | 91060927 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate |
| SMILES | C=CC=C(/N=C/OC)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C13H14FNO/c1-4-5-13(15-9-16-3)11-7-6-10(2)12(14)8-11/h4-9H,1H2,2-3H3/b13-5?,15-9+ |
| InChIKey | FXRRRMCOCVWNHK-MTEHXPAZSA-N |
| XLogP | 3.34 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|