About methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate
methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate (PubChem CID 91060927) has the molecular formula C13H14FNO
and a molecular weight of 219.26 g/mol. Its IUPAC name is methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate.
Molecular Properties
| Compound Name | methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate |
| PubChem CID | 91060927 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate |
| SMILES | C=CC=C(/N=C/OC)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C13H14FNO/c1-4-5-13(15-9-16-3)11-7-6-10(2)12(14)8-11/h4-9H,1H2,2-3H3/b13-5?,15-9+ |
| InChIKey | FXRRRMCOCVWNHK-MTEHXPAZSA-N |
| XLogP | 3.34 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate?
The IUPAC name of methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate (CID 91060927) is methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate.
What is the SMILES notation for methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate?
The canonical SMILES for methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate is C=CC=C(/N=C/OC)c1ccc(C)c(F)c1.
What is the InChIKey of methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate?
The InChIKey is FXRRRMCOCVWNHK-MTEHXPAZSA-N. The full InChI is InChI=1S/C13H14FNO/c1-4-5-13(15-9-16-3)11-7-6-10(2)12(14)8-11/h4-9H,1H2,2-3H3/b13-5?,15-9+.
What are the key properties of methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate?
methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate has a molecular weight of 219.26 g/mol, XLogP of 3.34, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[1-(3-fluoro-4-methylphenyl)buta-1,3-dienyl]methanimidate is sourced from PubChem (CID 91060927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).