C13H13F2N — CID 143767764
N-[(1Z)-1-(2,4-difluoro-6-methylphenyl)buta-1,3-dienyl]ethanimine (PubChem CID 143767764) has the molecular formula C13H13F2N and a molecular weight of 221.25 g/mol. Its IUPAC name is N-[(1Z)-1-(2,4-difluoro-6-methylphenyl)buta-1,3-dienyl]ethanimine.
| Compound Name | N-[(1Z)-1-(2,4-difluoro-6-methylphenyl)buta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 143767764 |
| Molecular Formula | C13H13F2N |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N-[(1Z)-1-(2,4-difluoro-6-methylphenyl)buta-1,3-dienyl]ethanimine |
| SMILES | C=C/C=C(\N=C\C)c1c(C)cc(F)cc1F |
| InChI | InChI=1S/C13H13F2N/c1-4-6-12(16-5-2)13-9(3)7-10(14)8-11(13)15/h4-8H,1H2,2-3H3/b12-6-,16-5+ |
| InChIKey | VTXQXURXIQTOTC-WJRVZUIRSA-N |
| XLogP | 3.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|