C11H14FNO2 — CID 177428425
(Z)-1-(3-fluoro-4-methylphenyl)-N,2-dimethoxyethanimine (PubChem CID 177428425) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is (Z)-1-(3-fluoro-4-methylphenyl)-N,2-dimethoxyethanimine.
| Compound Name | (Z)-1-(3-fluoro-4-methylphenyl)-N,2-dimethoxyethanimine |
|---|---|
| PubChem CID | 177428425 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (Z)-1-(3-fluoro-4-methylphenyl)-N,2-dimethoxyethanimine |
| SMILES | COC/C(=N\OC)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C11H14FNO2/c1-8-4-5-9(6-10(8)12)11(7-14-2)13-15-3/h4-6H,7H2,1-3H3/b13-11+ |
| InChIKey | PTPJVCOFRVTOQZ-ACCUITESSA-N |
| XLogP | 2.13 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|