C25H28F4N2O — CID 90910909
N'-[6-ethylidene-5,7-dimethyl-2-methylidene-4-(trifluoromethyl)deca-3,7,9-trienoxy]-3-fluoro-4-methyl-N-methylidenebenzenecarboximidamide (PubChem CID 90910909) has the molecular formula C25H28F4N2O and a molecular weight of 448.50 g/mol. Its IUPAC name is N'-[6-ethylidene-5,7-dimethyl-2-methylidene-4-(trifluoromethyl)deca-3,7,9-trienoxy]-3-fluoro-4-methyl-N-methylidenebenzenecarboximidamide.
| Compound Name | N'-[6-ethylidene-5,7-dimethyl-2-methylidene-4-(trifluoromethyl)deca-3,7,9-trienoxy]-3-fluoro-4-methyl-N-methylidenebenzenecarboximidamide |
|---|---|
| PubChem CID | 90910909 |
| Molecular Formula | C25H28F4N2O |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N'-[6-ethylidene-5,7-dimethyl-2-methylidene-4-(trifluoromethyl)deca-3,7,9-trienoxy]-3-fluoro-4-methyl-N-methylidenebenzenecarboximidamide |
| SMILES | C=CC=C(C)C(=CC)C(C)C(=CC(=C)CON=C(N=C)c1ccc(C)c(F)c1)C(F)(F)F |
| InChI | InChI=1S/C25H28F4N2O/c1-8-10-17(4)21(9-2)19(6)22(25(27,28)29)13-16(3)15-32-31-24(30-7)20-12-11-18(5)23(26)14-20/h8-14,19H,1,3,7,15H2,2,4-6H3 |
| InChIKey | SXOYAPLJGKSUBS-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|