C18H22FN — CID 170032437
N-[(2S,3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]-1-(3-fluoro-4-methylphenyl)ethanimine (PubChem CID 170032437) has the molecular formula C18H22FN and a molecular weight of 271.38 g/mol. Its IUPAC name is N-[(2S,3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]-1-(3-fluoro-4-methylphenyl)ethanimine.
| Compound Name | N-[(2S,3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]-1-(3-fluoro-4-methylphenyl)ethanimine |
|---|---|
| PubChem CID | 170032437 |
| Molecular Formula | C18H22FN |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | N-[(2S,3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]-1-(3-fluoro-4-methylphenyl)ethanimine |
| SMILES | C=C/C=C\C(=C/C)[C@H](C)/N=C(\C)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C18H22FN/c1-6-8-9-16(7-2)14(4)20-15(5)17-11-10-13(3)18(19)12-17/h6-12,14H,1H2,2-5H3/b9-8-,16-7+,20-15+/t14-/m0/s1 |
| InChIKey | XFVXQJPNQUJKEV-ACPIPTNPSA-N |
| XLogP | 5.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|