C18H21BrFN3O2 — CID 170106120
8-bromo-7-fluoro-1,3-dimethyl-9-(4-methylpentoxy)imidazo[4,5-c]quinolin-2-one (PubChem CID 170106120) has the molecular formula C18H21BrFN3O2 and a molecular weight of 410.29 g/mol. Its IUPAC name is 8-bromo-7-fluoro-1,3-dimethyl-9-(4-methylpentoxy)imidazo[4,5-c]quinolin-2-one.
| Compound Name | 8-bromo-7-fluoro-1,3-dimethyl-9-(4-methylpentoxy)imidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 170106120 |
| Molecular Formula | C18H21BrFN3O2 |
| Molecular Weight | 410.29 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 8-bromo-7-fluoro-1,3-dimethyl-9-(4-methylpentoxy)imidazo[4,5-c]quinolin-2-one |
| SMILES | CC(C)CCCOc1c(Br)c(F)cc2ncc3c(c12)n(C)c(=O)n3C |
| InChI | InChI=1S/C18H21BrFN3O2/c1-10(2)6-5-7-25-17-14-12(8-11(20)15(17)19)21-9-13-16(14)23(4)18(24)22(13)3/h8-10H,5-7H2,1-4H3 |
| InChIKey | KZGBGVQCXHZXQU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|