C11H15F2N — CID 170109541
5-butan-2-yl-2-(1,2-difluoroethyl)pyridine (PubChem CID 170109541) has the molecular formula C11H15F2N and a molecular weight of 199.24 g/mol. Its IUPAC name is 5-butan-2-yl-2-(1,2-difluoroethyl)pyridine.
| Compound Name | 5-butan-2-yl-2-(1,2-difluoroethyl)pyridine |
|---|---|
| PubChem CID | 170109541 |
| Molecular Formula | C11H15F2N |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 5-butan-2-yl-2-(1,2-difluoroethyl)pyridine |
| SMILES | CCC(C)c1ccc(C(F)CF)nc1 |
| InChI | InChI=1S/C11H15F2N/c1-3-8(2)9-4-5-11(14-7-9)10(13)6-12/h4-5,7-8,10H,3,6H2,1-2H3 |
| InChIKey | ZLNBPNRNCUQWLA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |