C11H16O9S — CID 170116424
2,3-bis(2-oxo-1,3-dioxolan-4-yl)butyl methanesulfonate (PubChem CID 170116424) has the molecular formula C11H16O9S and a molecular weight of 324.31 g/mol. Its IUPAC name is 2,3-bis(2-oxo-1,3-dioxolan-4-yl)butyl methanesulfonate.
| Compound Name | 2,3-bis(2-oxo-1,3-dioxolan-4-yl)butyl methanesulfonate |
|---|---|
| PubChem CID | 170116424 |
| Molecular Formula | C11H16O9S |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2,3-bis(2-oxo-1,3-dioxolan-4-yl)butyl methanesulfonate |
| SMILES | CC(C1COC(=O)O1)C(COS(C)(=O)=O)C1COC(=O)O1 |
| InChI | InChI=1S/C11H16O9S/c1-6(8-4-16-10(12)19-8)7(3-18-21(2,14)15)9-5-17-11(13)20-9/h6-9H,3-5H2,1-2H3 |
| InChIKey | SNKUPYJADSBZEE-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|