About 2-methylidene-3-(2-oxo-1,3-dioxolan-4-yl)butanoic acid
2-methylidene-3-(2-oxo-1,3-dioxolan-4-yl)butanoic acid (PubChem CID 22101666) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is 2-methylidene-3-(2-oxo-1,3-dioxolan-4-yl)butanoic acid.
Molecular Properties
| Compound Name | 2-methylidene-3-(2-oxo-1,3-dioxolan-4-yl)butanoic acid |
| PubChem CID | 22101666 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-methylidene-3-(2-oxo-1,3-dioxolan-4-yl)butanoic acid |
| SMILES | C=C(C(=O)O)C(C)C1COC(=O)O1 |
| InChI | InChI=1S/C8H10O5/c1-4(5(2)7(9)10)6-3-12-8(11)13-6/h4,6H,2-3H2,1H3,(H,9,10) |
| InChIKey | WDZXSFHJSORVPP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidene-3-(2-oxo-1,3-dioxolan-4-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-3-(2-oxo-1,3-dioxolan-4-yl)butanoic acid?
The IUPAC name of 2-methylidene-3-(2-oxo-1,3-dioxolan-4-yl)butanoic acid (CID 22101666) is 2-methylidene-3-(2-oxo-1,3-dioxolan-4-yl)butanoic acid.
What is the SMILES notation for 2-methylidene-3-(2-oxo-1,3-dioxolan-4-yl)butanoic acid?
The canonical SMILES for 2-methylidene-3-(2-oxo-1,3-dioxolan-4-yl)butanoic acid is C=C(C(=O)O)C(C)C1COC(=O)O1.
What is the InChIKey of 2-methylidene-3-(2-oxo-1,3-dioxolan-4-yl)butanoic acid?
The InChIKey is WDZXSFHJSORVPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O5/c1-4(5(2)7(9)10)6-3-12-8(11)13-6/h4,6H,2-3H2,1H3,(H,9,10).
What are the key properties of 2-methylidene-3-(2-oxo-1,3-dioxolan-4-yl)butanoic acid?
2-methylidene-3-(2-oxo-1,3-dioxolan-4-yl)butanoic acid has a molecular weight of 186.16 g/mol, XLogP of 0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-3-(2-oxo-1,3-dioxolan-4-yl)butanoic acid is sourced from PubChem (CID 22101666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).