C16H17ClFN4O2P — CID 170125435
6-chloro-5-fluoro-2-[formyl-(4-phosphanyl-2-propan-2-yl-3-pyridinyl)amino]-N-methylpyridine-3-carboxamide (PubChem CID 170125435) has the molecular formula C16H17ClFN4O2P and a molecular weight of 382.76 g/mol. Its IUPAC name is 6-chloro-5-fluoro-2-[formyl-(4-phosphanyl-2-propan-2-yl-3-pyridinyl)amino]-N-methylpyridine-3-carboxamide.
| Compound Name | 6-chloro-5-fluoro-2-[formyl-(4-phosphanyl-2-propan-2-yl-3-pyridinyl)amino]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 170125435 |
| Molecular Formula | C16H17ClFN4O2P |
| Molecular Weight | 382.76 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 6-chloro-5-fluoro-2-[formyl-(4-phosphanyl-2-propan-2-yl-3-pyridinyl)amino]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cc(F)c(Cl)nc1N(C=O)c1c(P)ccnc1C(C)C |
| InChI | InChI=1S/C16H17ClFN4O2P/c1-8(2)12-13(11(25)4-5-20-12)22(7-23)15-9(16(24)19-3)6-10(18)14(17)21-15/h4-8H,25H2,1-3H3,(H,19,24) |
| InChIKey | SSAXKCOFOCGZQK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.76 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|