C13H10Cl2FN4O2P — CID 154989331
2,6-dichloro-5-fluoro-N-[(4-methyl-2-phosphanyl-3-pyridinyl)carbamoyl]pyridine-3-carboxamide (PubChem CID 154989331) has the molecular formula C13H10Cl2FN4O2P and a molecular weight of 375.13 g/mol. Its IUPAC name is 2,6-dichloro-5-fluoro-N-[(4-methyl-2-phosphanyl-3-pyridinyl)carbamoyl]pyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-5-fluoro-N-[(4-methyl-2-phosphanyl-3-pyridinyl)carbamoyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154989331 |
| Molecular Formula | C13H10Cl2FN4O2P |
| Molecular Weight | 375.13 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 2,6-dichloro-5-fluoro-N-[(4-methyl-2-phosphanyl-3-pyridinyl)carbamoyl]pyridine-3-carboxamide |
| SMILES | Cc1ccnc(P)c1NC(=O)NC(=O)c1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C13H10Cl2FN4O2P/c1-5-2-3-17-12(23)8(5)18-13(22)20-11(21)6-4-7(16)10(15)19-9(6)14/h2-4H,23H2,1H3,(H2,18,20,21,22) |
| InChIKey | IPRGWHUSNCNVCZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.13 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|