C14H11Cl2FN4O2 — CID 146612498
2,6-dichloro-N-[(2,4-dimethyl-3-pyridinyl)carbamoyl]-5-fluoropyridine-3-carboxamide (PubChem CID 146612498) has the molecular formula C14H11Cl2FN4O2 and a molecular weight of 357.17 g/mol. Its IUPAC name is 2,6-dichloro-N-[(2,4-dimethyl-3-pyridinyl)carbamoyl]-5-fluoropyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-[(2,4-dimethyl-3-pyridinyl)carbamoyl]-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 146612498 |
| Molecular Formula | C14H11Cl2FN4O2 |
| Molecular Weight | 357.17 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 2,6-dichloro-N-[(2,4-dimethyl-3-pyridinyl)carbamoyl]-5-fluoropyridine-3-carboxamide |
| SMILES | Cc1ccnc(C)c1NC(=O)NC(=O)c1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C14H11Cl2FN4O2/c1-6-3-4-18-7(2)10(6)19-14(23)21-13(22)8-5-9(17)12(16)20-11(8)15/h3-5H,1-2H3,(H2,19,21,22,23) |
| InChIKey | XTCJVCLAMBZXHE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.17 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|