C17H17Cl3N4O2 — CID 163428284
2,5,6-trichloro-N-[(4-ethyl-2-propan-2-yl-3-pyridinyl)carbamoyl]pyridine-3-carboxamide (PubChem CID 163428284) has the molecular formula C17H17Cl3N4O2 and a molecular weight of 415.71 g/mol. Its IUPAC name is 2,5,6-trichloro-N-[(4-ethyl-2-propan-2-yl-3-pyridinyl)carbamoyl]pyridine-3-carboxamide.
| Compound Name | 2,5,6-trichloro-N-[(4-ethyl-2-propan-2-yl-3-pyridinyl)carbamoyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163428284 |
| Molecular Formula | C17H17Cl3N4O2 |
| Molecular Weight | 415.71 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 2,5,6-trichloro-N-[(4-ethyl-2-propan-2-yl-3-pyridinyl)carbamoyl]pyridine-3-carboxamide |
| SMILES | CCc1ccnc(C(C)C)c1NC(=O)NC(=O)c1cc(Cl)c(Cl)nc1Cl |
| InChI | InChI=1S/C17H17Cl3N4O2/c1-4-9-5-6-21-12(8(2)3)13(9)22-17(26)24-16(25)10-7-11(18)15(20)23-14(10)19/h5-8H,4H2,1-3H3,(H2,22,24,25,26) |
| InChIKey | AOJCRTXCQNGFGA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.71 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|