C13H7Cl6N5O3 — CID 165098841
N-carbamoyl-2,5,6-trichloropyridine-3-carboxamide;2,5,6-trichloropyridine-3-carboxamide (PubChem CID 165098841) has the molecular formula C13H7Cl6N5O3 and a molecular weight of 493.95 g/mol. Its IUPAC name is N-carbamoyl-2,5,6-trichloropyridine-3-carboxamide;2,5,6-trichloropyridine-3-carboxamide.
| Compound Name | N-carbamoyl-2,5,6-trichloropyridine-3-carboxamide;2,5,6-trichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 165098841 |
| Molecular Formula | C13H7Cl6N5O3 |
| Molecular Weight | 493.95 g/mol |
| Exact Mass | 490.87 |
| IUPAC Name | N-carbamoyl-2,5,6-trichloropyridine-3-carboxamide;2,5,6-trichloropyridine-3-carboxamide |
| SMILES | NC(=O)NC(=O)c1cc(Cl)c(Cl)nc1Cl.NC(=O)c1cc(Cl)c(Cl)nc1Cl |
| InChI | InChI=1S/C7H4Cl3N3O2.C6H3Cl3N2O/c8-3-1-2(4(9)12-5(3)10)6(14)13-7(11)15;7-3-1-2(6(10)12)4(8)11-5(3)9/h1H,(H3,11,13,14,15);1H,(H2,10,12) |
| InChIKey | XZBXORSIWDFVEY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.95 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|