C20H15Cl2FN4O2 — CID 163370920
N-[(2-benzyl-4-methyl-3-pyridinyl)carbamoyl]-2,6-dichloro-5-fluoropyridine-3-carboxamide (PubChem CID 163370920) has the molecular formula C20H15Cl2FN4O2 and a molecular weight of 433.27 g/mol. Its IUPAC name is N-[(2-benzyl-4-methyl-3-pyridinyl)carbamoyl]-2,6-dichloro-5-fluoropyridine-3-carboxamide.
| Compound Name | N-[(2-benzyl-4-methyl-3-pyridinyl)carbamoyl]-2,6-dichloro-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 163370920 |
| Molecular Formula | C20H15Cl2FN4O2 |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | N-[(2-benzyl-4-methyl-3-pyridinyl)carbamoyl]-2,6-dichloro-5-fluoropyridine-3-carboxamide |
| SMILES | Cc1ccnc(Cc2ccccc2)c1NC(=O)NC(=O)c1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C20H15Cl2FN4O2/c1-11-7-8-24-15(9-12-5-3-2-4-6-12)16(11)25-20(29)27-19(28)13-10-14(23)18(22)26-17(13)21/h2-8,10H,9H2,1H3,(H2,25,27,28,29) |
| InChIKey | OGLALTSTPPJPRR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|